C22H27N5O2S — CID 175340207
4-benzyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 175340207) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-benzyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 4-benzyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 175340207 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-benzyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | O=c1sn(CCCCN2CCN(c3ccccn3)CC2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H27N5O2S/c28-21-26(18-19-8-2-1-3-9-19)22(29)30-27(21)13-7-6-12-24-14-16-25(17-15-24)20-10-4-5-11-23-20/h1-5,8-11H,6-7,12-18H2 |
| InChIKey | KRBAFKSQOCYONW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|