C27H30ClN5O2 — CID 11656141
4-phenyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]pyrido[1,2-c]pyrimidine-1,3-dione;hydrochloride (PubChem CID 11656141) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 4-phenyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]pyrido[1,2-c]pyrimidine-1,3-dione;hydrochloride.
| Compound Name | 4-phenyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]pyrido[1,2-c]pyrimidine-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 11656141 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 4-phenyl-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]pyrido[1,2-c]pyrimidine-1,3-dione;hydrochloride |
| SMILES | Cl.O=c1c(-c2ccccc2)c2ccccn2c(=O)n1CCCCN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C27H29N5O2.ClH/c33-26-25(22-10-2-1-3-11-22)23-12-5-7-16-31(23)27(34)32(26)17-9-8-15-29-18-20-30(21-19-29)24-13-4-6-14-28-24;/h1-7,10-14,16H,8-9,15,17-21H2;1H |
| InChIKey | JWYONSLUGSLTRR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|