C20H26N6O — CID 165127999
3-[5-(4-pyrimidin-4-ylpiperazin-1-yl)pentyl]-1H-benzimidazol-2-one (PubChem CID 165127999) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[5-(4-pyrimidin-4-ylpiperazin-1-yl)pentyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[5-(4-pyrimidin-4-ylpiperazin-1-yl)pentyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 165127999 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3-[5-(4-pyrimidin-4-ylpiperazin-1-yl)pentyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCCCCN1CCN(c2ccncn2)CC1 |
| InChI | InChI=1S/C20H26N6O/c27-20-23-17-6-2-3-7-18(17)26(20)11-5-1-4-10-24-12-14-25(15-13-24)19-8-9-21-16-22-19/h2-3,6-9,16H,1,4-5,10-15H2,(H,23,27) |
| InChIKey | KZIOAMPRCIXZNH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|