C20H24N4OS — CID 57085480
2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one (PubChem CID 57085480) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one.
| Compound Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 57085480 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one |
| SMILES | O=C1CN(CCCN2CCN(c3ccccn3)CC2)Sc2ccccc21 |
| InChI | InChI=1S/C20H24N4OS/c25-18-16-24(26-19-7-2-1-6-17(18)19)11-5-10-22-12-14-23(15-13-22)20-8-3-4-9-21-20/h1-4,6-9H,5,10-16H2 |
| InChIKey | ZSBJUVLHOKTSKR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|