C22H28N4O3S2 — CID 90965145
N-[4-[4-[3-(4-oxo-3H-1,2-benzothiazin-2-yl)propyl]piperazin-1-yl]phenyl]methanesulfonamide (PubChem CID 90965145) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is N-[4-[4-[3-(4-oxo-3H-1,2-benzothiazin-2-yl)propyl]piperazin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[3-(4-oxo-3H-1,2-benzothiazin-2-yl)propyl]piperazin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90965145 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[4-[4-[3-(4-oxo-3H-1,2-benzothiazin-2-yl)propyl]piperazin-1-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(N2CCN(CCCN3CC(=O)c4ccccc4S3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O3S2/c1-31(28,29)23-18-7-9-19(10-8-18)25-15-13-24(14-16-25)11-4-12-26-17-21(27)20-5-2-3-6-22(20)30-26/h2-3,5-10,23H,4,11-17H2,1H3 |
| InChIKey | GKOIQGAQMJEERN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|