C21H26N4O2S — CID 57218486
5-methoxy-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one (PubChem CID 57218486) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 5-methoxy-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one.
| Compound Name | 5-methoxy-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 57218486 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-methoxy-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-1,2-benzothiazin-4-one |
| SMILES | COc1cccc2c1C(=O)CN(CCCN1CCN(c3ccccn3)CC1)S2 |
| InChI | InChI=1S/C21H26N4O2S/c1-27-18-6-4-7-19-21(18)17(26)16-25(28-19)11-5-10-23-12-14-24(15-13-23)20-8-2-3-9-22-20/h2-4,6-9H,5,10-16H2,1H3 |
| InChIKey | LUVPCULTRGGNAW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|