C22H31Cl2N3O5 — CID 13098063
3-(4-pyridin-2-ylpiperazin-1-yl)propyl 3,4,5-trimethoxybenzoate;dihydrochloride (PubChem CID 13098063) has the molecular formula C22H31Cl2N3O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is 3-(4-pyridin-2-ylpiperazin-1-yl)propyl 3,4,5-trimethoxybenzoate;dihydrochloride.
| Compound Name | 3-(4-pyridin-2-ylpiperazin-1-yl)propyl 3,4,5-trimethoxybenzoate;dihydrochloride |
|---|---|
| PubChem CID | 13098063 |
| Molecular Formula | C22H31Cl2N3O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 3-(4-pyridin-2-ylpiperazin-1-yl)propyl 3,4,5-trimethoxybenzoate;dihydrochloride |
| SMILES | COc1cc(C(=O)OCCCN2CCN(c3ccccn3)CC2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C22H29N3O5.2ClH/c1-27-18-15-17(16-19(28-2)21(18)29-3)22(26)30-14-6-9-24-10-12-25(13-11-24)20-7-4-5-8-23-20;;/h4-5,7-8,15-16H,6,9-14H2,1-3H3;2*1H |
| InChIKey | NSYPLRIVHDWHHI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|