C19H27BN2O5 — CID 170609268
3-(4-cyano-1,4-azaborepan-1-yl)propyl 3,4,5-trimethoxybenzoate (PubChem CID 170609268) has the molecular formula C19H27BN2O5 and a molecular weight of 374.25 g/mol. Its IUPAC name is 3-(4-cyano-1,4-azaborepan-1-yl)propyl 3,4,5-trimethoxybenzoate.
| Compound Name | 3-(4-cyano-1,4-azaborepan-1-yl)propyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 170609268 |
| Molecular Formula | C19H27BN2O5 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-(4-cyano-1,4-azaborepan-1-yl)propyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCN2CCCB(C#N)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H27BN2O5/c1-24-16-12-15(13-17(25-2)18(16)26-3)19(23)27-11-5-9-22-8-4-6-20(14-21)7-10-22/h12-13H,4-11H2,1-3H3 |
| InChIKey | PTVXXXFVBRQYDO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|