C34H50N2O10 — CID 56589395
4-[3,3-dimethyl-4-[4-(3,4,5-trimethoxybenzoyl)oxybutyl]piperazin-1-yl]butyl 3,4,5-trimethoxybenzoate (PubChem CID 56589395) has the molecular formula C34H50N2O10 and a molecular weight of 646.78 g/mol. Its IUPAC name is 4-[3,3-dimethyl-4-[4-(3,4,5-trimethoxybenzoyl)oxybutyl]piperazin-1-yl]butyl 3,4,5-trimethoxybenzoate.
| Compound Name | 4-[3,3-dimethyl-4-[4-(3,4,5-trimethoxybenzoyl)oxybutyl]piperazin-1-yl]butyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 56589395 |
| Molecular Formula | C34H50N2O10 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | 4-[3,3-dimethyl-4-[4-(3,4,5-trimethoxybenzoyl)oxybutyl]piperazin-1-yl]butyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCCN2CCN(CCCCOC(=O)c3cc(OC)c(OC)c(OC)c3)C(C)(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C34H50N2O10/c1-34(2)23-35(13-9-11-17-45-32(37)24-19-26(39-3)30(43-7)27(20-24)40-4)15-16-36(34)14-10-12-18-46-33(38)25-21-28(41-5)31(44-8)29(22-25)42-6/h19-22H,9-18,23H2,1-8H3 |
| InChIKey | FCTANTXOYZZAMO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|