C28H38N2O10 — CID 110184847
2-hydroxy-2-oxoacetate;3-[4-(1-hydroxy-1-phenylpropan-2-yl)piperazin-4-ium-1-yl]propyl 3,4,5-trimethoxybenzoate (PubChem CID 110184847) has the molecular formula C28H38N2O10 and a molecular weight of 562.62 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;3-[4-(1-hydroxy-1-phenylpropan-2-yl)piperazin-4-ium-1-yl]propyl 3,4,5-trimethoxybenzoate.
| Compound Name | 2-hydroxy-2-oxoacetate;3-[4-(1-hydroxy-1-phenylpropan-2-yl)piperazin-4-ium-1-yl]propyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 110184847 |
| Molecular Formula | C28H38N2O10 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;3-[4-(1-hydroxy-1-phenylpropan-2-yl)piperazin-4-ium-1-yl]propyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCN2CC[NH+](C(C)C(O)c3ccccc3)CC2)cc(OC)c1OC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C26H36N2O6.C2H2O4/c1-19(24(29)20-9-6-5-7-10-20)28-14-12-27(13-15-28)11-8-16-34-26(30)21-17-22(31-2)25(33-4)23(18-21)32-3;3-1(4)2(5)6/h5-7,9-10,17-19,24,29H,8,11-16H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | UWQLRAJORNAVFP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|