C22H28ClNO5 — CID 110185447
3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl 3,4,5-trimethoxybenzoate chloride (PubChem CID 110185447) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl 3,4,5-trimethoxybenzoate chloride.
| Compound Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl 3,4,5-trimethoxybenzoate chloride |
|---|---|
| PubChem CID | 110185447 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl 3,4,5-trimethoxybenzoate chloride |
| SMILES | COc1cc(C(=O)OCCC[NH+]2CCc3ccccc3C2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C22H27NO5.ClH/c1-25-19-13-18(14-20(26-2)21(19)27-3)22(24)28-12-6-10-23-11-9-16-7-4-5-8-17(16)15-23;/h4-5,7-8,13-14H,6,9-12,15H2,1-3H3;1H |
| InChIKey | ODZLXGYMXKVMFR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|