C31H40Cl2N4O5S — CID 110174337
3-[4-(3-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)piperazine-1,4-diium-1-yl]propyl 3,4,5-trimethoxybenzoate dichloride (PubChem CID 110174337) has the molecular formula C31H40Cl2N4O5S and a molecular weight of 651.66 g/mol. Its IUPAC name is 3-[4-(3-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)piperazine-1,4-diium-1-yl]propyl 3,4,5-trimethoxybenzoate dichloride.
| Compound Name | 3-[4-(3-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)piperazine-1,4-diium-1-yl]propyl 3,4,5-trimethoxybenzoate dichloride |
|---|---|
| PubChem CID | 110174337 |
| Molecular Formula | C31H40Cl2N4O5S |
| Molecular Weight | 651.66 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 3-[4-(3-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)piperazine-1,4-diium-1-yl]propyl 3,4,5-trimethoxybenzoate dichloride |
| SMILES | COc1cc(C(=O)OCCC[NH+]2CC[NH+](CCCN3c4ccccc4Sc4cccnc43)CC2)cc(OC)c1OC.[Cl-].[Cl-] |
| InChI | InChI=1S/C31H38N4O5S.2ClH/c1-37-25-21-23(22-26(38-2)29(25)39-3)31(36)40-20-8-14-34-18-16-33(17-19-34)13-7-15-35-24-9-4-5-10-27(24)41-28-11-6-12-32-30(28)35;;/h4-6,9-12,21-22H,7-8,13-20H2,1-3H3;2*1H |
| InChIKey | KBHWBGBBFQTAGR-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.66 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|