C28H28N5S2+ — CID 68631134
dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium (PubChem CID 68631134) has the molecular formula C28H28N5S2+ and a molecular weight of 498.70 g/mol. Its IUPAC name is dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium.
| Compound Name | dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium |
|---|---|
| PubChem CID | 68631134 |
| Molecular Formula | C28H28N5S2+ |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium |
| SMILES | C[N+](C)(CCN1c2ccccc2Sc2cccnc21)CCN1c2ccccc2Sc2cccnc21 |
| InChI | InChI=1S/C28H28N5S2/c1-33(2,19-17-31-21-9-3-5-11-23(21)34-25-13-7-15-29-27(25)31)20-18-32-22-10-4-6-12-24(22)35-26-14-8-16-30-28(26)32/h3-16H,17-20H2,1-2H3/q+1 |
| InChIKey | PHOOVVQFVLYKAV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|