C17H22N3S+ — CID 110173961
trimethyl(1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-yl)azanium (PubChem CID 110173961) has the molecular formula C17H22N3S+ and a molecular weight of 300.45 g/mol. Its IUPAC name is trimethyl(1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-yl)azanium.
| Compound Name | trimethyl(1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-yl)azanium |
|---|---|
| PubChem CID | 110173961 |
| Molecular Formula | C17H22N3S+ |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | trimethyl(1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-yl)azanium |
| SMILES | CC(CN1c2ccccc2Sc2cccnc21)[N+](C)(C)C |
| InChI | InChI=1S/C17H22N3S/c1-13(20(2,3)4)12-19-14-8-5-6-9-15(14)21-16-10-7-11-18-17(16)19/h5-11,13H,12H2,1-4H3/q+1 |
| InChIKey | HYCWCIXYGUMGHW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|