About cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium
cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium (PubChem CID 68631133) has the molecular formula C33H38N5S2+
and a molecular weight of 568.84 g/mol. Its IUPAC name is cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium.
Molecular Properties
| Compound Name | cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium |
| PubChem CID | 68631133 |
| Molecular Formula | C33H38N5S2+ |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium |
| SMILES | C1CCCC1.C[N+](C)(CCN1c2ccccc2Sc2cccnc21)CCN1c2ccccc2Sc2cccnc21 |
| InChI | InChI=1S/C28H28N5S2.C5H10/c1-33(2,19-17-31-21-9-3-5-11-23(21)34-25-13-7-15-29-27(25)31)20-18-32-22-10-4-6-12-24(22)35-26-14-8-16-30-28(26)32;1-2-4-5-3-1/h3-16H,17-20H2,1-2H3;1-5H2/q+1; |
| InChIKey | VZJWSWGMPKJMNK-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium?
The IUPAC name of cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium (CID 68631133) is cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium.
What is the SMILES notation for cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium?
The canonical SMILES for cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium is C1CCCC1.C[N+](C)(CCN1c2ccccc2Sc2cccnc21)CCN1c2ccccc2Sc2cccnc21.
What is the InChIKey of cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium?
The InChIKey is VZJWSWGMPKJMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N5S2.C5H10/c1-33(2,19-17-31-21-9-3-5-11-23(21)34-25-13-7-15-29-27(25)31)20-18-32-22-10-4-6-12-24(22)35-26-14-8-16-30-28(26)32;1-2-4-5-3-1/h3-16H,17-20H2,1-2H3;1-5H2/q+1;.
What are the key properties of cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium?
cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium has a molecular weight of 568.84 g/mol, XLogP of 8.41, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;dimethyl-bis(2-pyrido[3,2-b][1,4]benzothiazin-10-ylethyl)azanium is sourced from PubChem (CID 68631133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).