C22H28FN3OS — CID 57207443
2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methoxy-3,4-dihydro-1,2-benzothiazine (PubChem CID 57207443) has the molecular formula C22H28FN3OS and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methoxy-3,4-dihydro-1,2-benzothiazine.
| Compound Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methoxy-3,4-dihydro-1,2-benzothiazine |
|---|---|
| PubChem CID | 57207443 |
| Molecular Formula | C22H28FN3OS |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methoxy-3,4-dihydro-1,2-benzothiazine |
| SMILES | COc1cccc2c1CCN(CCCN1CCN(c3ccc(F)cc3)CC1)S2 |
| InChI | InChI=1S/C22H28FN3OS/c1-27-21-4-2-5-22-20(21)10-13-26(28-22)12-3-11-24-14-16-25(17-15-24)19-8-6-18(23)7-9-19/h2,4-9H,3,10-17H2,1H3 |
| InChIKey | IIVMMFQJAGOQEB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|