C24H32FN3O4S — CID 18759878
2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-4,5-dimethoxy-3,4-dihydro-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 18759878) has the molecular formula C24H32FN3O4S and a molecular weight of 477.60 g/mol. Its IUPAC name is 2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-4,5-dimethoxy-3,4-dihydro-1λ6,2-benzothiazine 1,1-dioxide.
| Compound Name | 2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-4,5-dimethoxy-3,4-dihydro-1λ6,2-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 18759878 |
| Molecular Formula | C24H32FN3O4S |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-4,5-dimethoxy-3,4-dihydro-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | COc1cccc2c1C(OC)CN(CCCCN1CCN(c3ccc(F)cc3)CC1)S2(=O)=O |
| InChI | InChI=1S/C24H32FN3O4S/c1-31-21-6-5-7-23-24(21)22(32-2)18-28(33(23,29)30)13-4-3-12-26-14-16-27(17-15-26)20-10-8-19(25)9-11-20/h5-11,22H,3-4,12-18H2,1-2H3 |
| InChIKey | GARPAUJQEVBDPY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|