C20H26FN5O3S — CID 22065891
(NE)-N-[2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methyl-1,1-dioxo-3H-pyrrolo[2,3-e]thiazin-4-ylidene]hydroxylamine (PubChem CID 22065891) has the molecular formula C20H26FN5O3S and a molecular weight of 435.53 g/mol. Its IUPAC name is (NE)-N-[2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methyl-1,1-dioxo-3H-pyrrolo[2,3-e]thiazin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methyl-1,1-dioxo-3H-pyrrolo[2,3-e]thiazin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 22065891 |
| Molecular Formula | C20H26FN5O3S |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (NE)-N-[2-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-methyl-1,1-dioxo-3H-pyrrolo[2,3-e]thiazin-4-ylidene]hydroxylamine |
| SMILES | Cn1ccc2c1/C(=N/O)CN(CCCN1CCN(c3ccc(F)cc3)CC1)S2(=O)=O |
| InChI | InChI=1S/C20H26FN5O3S/c1-23-10-7-19-20(23)18(22-27)15-26(30(19,28)29)9-2-8-24-11-13-25(14-12-24)17-5-3-16(21)4-6-17/h3-7,10,27H,2,8-9,11-15H2,1H3/b22-18+ |
| InChIKey | TYUWMYAGMRPBAM-RELWKKBWSA-N |
| XLogP | 1.56 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|