C23H31FN4O2 — CID 10549726
5-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one (PubChem CID 10549726) has the molecular formula C23H31FN4O2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 5-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one.
| Compound Name | 5-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 10549726 |
| Molecular Formula | C23H31FN4O2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 5-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one |
| SMILES | Cn1ccc2c1C(O)CCN(CCCCN1CCN(c3ccc(F)cc3)CC1)C2=O |
| InChI | InChI=1S/C23H31FN4O2/c1-25-12-8-20-22(25)21(29)9-13-28(23(20)30)11-3-2-10-26-14-16-27(17-15-26)19-6-4-18(24)5-7-19/h4-8,12,21,29H,2-3,9-11,13-17H2,1H3 |
| InChIKey | IJYYJGUKSOOLMT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|