C12H17N2O2Y- — CID 59960662
8-hydroxy-1-methyl-5-propyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one;yttrium (PubChem CID 59960662) has the molecular formula C12H17N2O2Y- and a molecular weight of 310.19 g/mol. Its IUPAC name is 8-hydroxy-1-methyl-5-propyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one;yttrium.
| Compound Name | 8-hydroxy-1-methyl-5-propyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one;yttrium |
|---|---|
| PubChem CID | 59960662 |
| Molecular Formula | C12H17N2O2Y- |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 8-hydroxy-1-methyl-5-propyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one;yttrium |
| SMILES | [CH2-]CCN1CCC(O)c2c(ccn2C)C1=O.[Y] |
| InChI | InChI=1S/C12H17N2O2.Y/c1-3-6-14-8-5-10(15)11-9(12(14)16)4-7-13(11)2;/h4,7,10,15H,1,3,5-6,8H2,2H3;/q-1; |
| InChIKey | MMNCZSDJLULHKF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|