C26H37N3O4S3 — CID 18759924
4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-1,1-dioxo-3H-1λ6,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol (PubChem CID 18759924) has the molecular formula C26H37N3O4S3 and a molecular weight of 551.80 g/mol. Its IUPAC name is 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-1,1-dioxo-3H-1λ6,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-1,1-dioxo-3H-1λ6,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 18759924 |
| Molecular Formula | C26H37N3O4S3 |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-1,1-dioxo-3H-1λ6,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol |
| SMILES | CCSC1(SCC)CN(CCCN2CCN(c3ccc(O)cc3)CC2)S(=O)(=O)c2cccc(OC)c21 |
| InChI | InChI=1S/C26H37N3O4S3/c1-4-34-26(35-5-2)20-29(36(31,32)24-9-6-8-23(33-3)25(24)26)15-7-14-27-16-18-28(19-17-27)21-10-12-22(30)13-11-21/h6,8-13,30H,4-5,7,14-20H2,1-3H3 |
| InChIKey | SZMCWSYQLPSGSI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|