C15H22ClNO5S — CID 18759879
2-(4-chlorobutyl)-4,4,5-trimethoxy-3H-1lambda6,2-benzothiazine 1,1-dioxide (PubChem CID 18759879) has the molecular formula C15H22ClNO5S and a molecular weight of 363.86 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-4,4,5-trimethoxy-3H-1lambda6,2-benzothiazine 1,1-dioxide.
| Compound Name | 2-(4-chlorobutyl)-4,4,5-trimethoxy-3H-1lambda6,2-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 18759879 |
| Molecular Formula | C15H22ClNO5S |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(4-chlorobutyl)-4,4,5-trimethoxy-3H-1lambda6,2-benzothiazine 1,1-dioxide |
| SMILES | COc1cccc2c1C(OC)(OC)CN(CCCCCl)S2(=O)=O |
| InChI | InChI=1S/C15H22ClNO5S/c1-20-12-7-6-8-13-14(12)15(21-2,22-3)11-17(23(13,18)19)10-5-4-9-16/h6-8H,4-5,9-11H2,1-3H3 |
| InChIKey | RIYJQPQVRQSKAA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|