C10H13NO4S — CID 117200257
O-[(4-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]hydroxylamine (PubChem CID 117200257) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is O-[(4-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117200257 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | O-[(4-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)methyl]hydroxylamine |
| SMILES | COc1cccc2c1C(CON)CS2(=O)=O |
| InChI | InChI=1S/C10H13NO4S/c1-14-8-3-2-4-9-10(8)7(5-15-11)6-16(9,12)13/h2-4,7H,5-6,11H2,1H3 |
| InChIKey | UUSNQKYSSZYGRL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|