C16H20N4O2S — CID 15735407
N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]methanesulfonamide (PubChem CID 15735407) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 15735407 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(N2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-23(21,22)18-14-2-4-15(5-3-14)19-10-12-20(13-11-19)16-6-8-17-9-7-16/h2-9,18H,10-13H2,1H3 |
| InChIKey | YQDJHAGRQULEOJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|