C19H25N5O3S — CID 143632110
3-(methanesulfonamido)-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide (PubChem CID 143632110) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(methanesulfonamido)-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 143632110 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-(methanesulfonamido)-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CS(=O)(=O)NCCC(=O)Nc1ccc(N2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C19H25N5O3S/c1-28(26,27)21-11-8-19(25)22-16-2-4-17(5-3-16)23-12-14-24(15-13-23)18-6-9-20-10-7-18/h2-7,9-10,21H,8,11-15H2,1H3,(H,22,25) |
| InChIKey | QCGJHOWJASACRA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|