C19H25N5O — CID 108999704
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(pyridin-4-ylmethylamino)acetamide (PubChem CID 108999704) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(pyridin-4-ylmethylamino)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(pyridin-4-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 108999704 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(pyridin-4-ylmethylamino)acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CNCc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C19H25N5O/c1-23-10-12-24(13-11-23)18-4-2-17(3-5-18)22-19(25)15-21-14-16-6-8-20-9-7-16/h2-9,21H,10-15H2,1H3,(H,22,25) |
| InChIKey | DUEZYIQULKPSGR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|