C19H22FN3O3S — CID 18280052
3-[(4-fluorophenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 18280052) has the molecular formula C19H22FN3O3S and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 18280052 |
| Molecular Formula | C19H22FN3O3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)cc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H22FN3O3S/c20-15-3-9-18(10-4-15)27(25,26)21-12-11-19(24)22-16-5-7-17(8-6-16)23-13-1-2-14-23/h3-10,21H,1-2,11-14H2,(H,22,24) |
| InChIKey | CGELDQOGNFXTDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|