C28H35N5O2S — CID 88871441
3-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide (PubChem CID 88871441) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is 3-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 88871441 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]-N-[4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]propanamide |
| SMILES | COc1cc(C)c(SN(C)CCC(=O)Nc2ccc(N3CCN(c4ccncc4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H35N5O2S/c1-21-19-26(35-4)20-22(2)28(21)36-31(3)14-11-27(34)30-23-5-7-24(8-6-23)32-15-17-33(18-16-32)25-9-12-29-13-10-25/h5-10,12-13,19-20H,11,14-18H2,1-4H3,(H,30,34) |
| InChIKey | HKTFQSMAYQYLMD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|