C27H40N4O3S — CID 143632317
N-[4-[4-(dimethylamino)azepan-1-yl]phenyl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide (PubChem CID 143632317) has the molecular formula C27H40N4O3S and a molecular weight of 500.71 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)azepan-1-yl]phenyl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide.
| Compound Name | N-[4-[4-(dimethylamino)azepan-1-yl]phenyl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide |
|---|---|
| PubChem CID | 143632317 |
| Molecular Formula | C27H40N4O3S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-[4-[4-(dimethylamino)azepan-1-yl]phenyl]-3-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]propanamide |
| SMILES | COc1cc(C)c(S(=O)N(C)CCC(=O)Nc2ccc(N3CCCC(N(C)C)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H40N4O3S/c1-20-18-25(34-6)19-21(2)27(20)35(33)30(5)16-14-26(32)28-22-9-11-24(12-10-22)31-15-7-8-23(13-17-31)29(3)4/h9-12,18-19,23H,7-8,13-17H2,1-6H3,(H,28,32) |
| InChIKey | NAXWQLNBEFYBIQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|