C23H30Cl2N4O2S — CID 143632106
3-[(2,3-dichlorophenyl)sulfinyl-methylamino]-N-[4-[3-(dimethylamino)piperidin-1-yl]phenyl]propanamide (PubChem CID 143632106) has the molecular formula C23H30Cl2N4O2S and a molecular weight of 497.49 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)sulfinyl-methylamino]-N-[4-[3-(dimethylamino)piperidin-1-yl]phenyl]propanamide.
| Compound Name | 3-[(2,3-dichlorophenyl)sulfinyl-methylamino]-N-[4-[3-(dimethylamino)piperidin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 143632106 |
| Molecular Formula | C23H30Cl2N4O2S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)sulfinyl-methylamino]-N-[4-[3-(dimethylamino)piperidin-1-yl]phenyl]propanamide |
| SMILES | CN(C)C1CCCN(c2ccc(NC(=O)CCN(C)S(=O)c3cccc(Cl)c3Cl)cc2)C1 |
| InChI | InChI=1S/C23H30Cl2N4O2S/c1-27(2)19-6-5-14-29(16-19)18-11-9-17(10-12-18)26-22(30)13-15-28(3)32(31)21-8-4-7-20(24)23(21)25/h4,7-12,19H,5-6,13-16H2,1-3H3,(H,26,30) |
| InChIKey | XCFOGTZRPODKGS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|