C18H20ClN5O2S — CID 146647459
N-[4-[4-(6-chloro-1H-indazol-4-yl)piperazin-1-yl]phenyl]methanesulfonamide (PubChem CID 146647459) has the molecular formula C18H20ClN5O2S and a molecular weight of 405.91 g/mol. Its IUPAC name is N-[4-[4-(6-chloro-1H-indazol-4-yl)piperazin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-(6-chloro-1H-indazol-4-yl)piperazin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 146647459 |
| Molecular Formula | C18H20ClN5O2S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[4-[4-(6-chloro-1H-indazol-4-yl)piperazin-1-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(N2CCN(c3cc(Cl)cc4[nH]ncc34)CC2)cc1 |
| InChI | InChI=1S/C18H20ClN5O2S/c1-27(25,26)22-14-2-4-15(5-3-14)23-6-8-24(9-7-23)18-11-13(19)10-17-16(18)12-20-21-17/h2-5,10-12,22H,6-9H2,1H3,(H,20,21) |
| InChIKey | WCLVDMCSSGLOSH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|