C20H25ClN4S — CID 145075688
6-chloro-4-[4-(4-methylphenyl)piperidin-1-yl]-1H-indazole;S-methylthiohydroxylamine (PubChem CID 145075688) has the molecular formula C20H25ClN4S and a molecular weight of 388.97 g/mol. Its IUPAC name is 6-chloro-4-[4-(4-methylphenyl)piperidin-1-yl]-1H-indazole;S-methylthiohydroxylamine.
| Compound Name | 6-chloro-4-[4-(4-methylphenyl)piperidin-1-yl]-1H-indazole;S-methylthiohydroxylamine |
|---|---|
| PubChem CID | 145075688 |
| Molecular Formula | C20H25ClN4S |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 6-chloro-4-[4-(4-methylphenyl)piperidin-1-yl]-1H-indazole;S-methylthiohydroxylamine |
| SMILES | CSN.Cc1ccc(C2CCN(c3cc(Cl)cc4[nH]ncc34)CC2)cc1 |
| InChI | InChI=1S/C19H20ClN3.CH5NS/c1-13-2-4-14(5-3-13)15-6-8-23(9-7-15)19-11-16(20)10-18-17(19)12-21-22-18;1-3-2/h2-5,10-12,15H,6-9H2,1H3,(H,21,22);2H2,1H3 |
| InChIKey | HTTPALSCJWWNRG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|