C14H17ClN4O — CID 121326810
1-(6-chloro-1H-indazol-4-yl)-N-methylpiperidine-4-carboxamide (PubChem CID 121326810) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 1-(6-chloro-1H-indazol-4-yl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-1H-indazol-4-yl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 121326810 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(6-chloro-1H-indazol-4-yl)-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(c2cc(Cl)cc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C14H17ClN4O/c1-16-14(20)9-2-4-19(5-3-9)13-7-10(15)6-12-11(13)8-17-18-12/h6-9H,2-5H2,1H3,(H,16,20)(H,17,18) |
| InChIKey | NFJLSGLOUDEDTE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |