C16H21ClN4O — CID 146516487
1-[1-(6-chloro-1H-indazol-4-yl)piperidin-4-yl]pyrrolidin-2-ol (PubChem CID 146516487) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[1-(6-chloro-1H-indazol-4-yl)piperidin-4-yl]pyrrolidin-2-ol.
| Compound Name | 1-[1-(6-chloro-1H-indazol-4-yl)piperidin-4-yl]pyrrolidin-2-ol |
|---|---|
| PubChem CID | 146516487 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[1-(6-chloro-1H-indazol-4-yl)piperidin-4-yl]pyrrolidin-2-ol |
| SMILES | OC1CCCN1C1CCN(c2cc(Cl)cc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C16H21ClN4O/c17-11-8-14-13(10-18-19-14)15(9-11)20-6-3-12(4-7-20)21-5-1-2-16(21)22/h8-10,12,16,22H,1-7H2,(H,18,19) |
| InChIKey | QPXVZXKZCGPAGI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |