C21H24ClN3OS — CID 57158735
2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-3H-1,2-benzothiazin-4-one (PubChem CID 57158735) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-3H-1,2-benzothiazin-4-one.
| Compound Name | 2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-3H-1,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 57158735 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-3H-1,2-benzothiazin-4-one |
| SMILES | O=C1CN(CCCN2CCN(c3ccc(Cl)cc3)CC2)Sc2ccccc21 |
| InChI | InChI=1S/C21H24ClN3OS/c22-17-6-8-18(9-7-17)24-14-12-23(13-15-24)10-3-11-25-16-20(26)19-4-1-2-5-21(19)27-25/h1-2,4-9H,3,10-16H2 |
| InChIKey | YJHUADMJRUWYLL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|