C23H29ClN2O2S — CID 21048744
1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-chlorophenyl)piperazine (PubChem CID 21048744) has the molecular formula C23H29ClN2O2S and a molecular weight of 433.02 g/mol. Its IUPAC name is 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-chlorophenyl)piperazine.
| Compound Name | 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 21048744 |
| Molecular Formula | C23H29ClN2O2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-chlorophenyl)piperazine |
| SMILES | O=S(=O)(c1ccccc1)C1(CCCN2CCN(c3ccc(Cl)cc3)CC2)CCC1 |
| InChI | InChI=1S/C23H29ClN2O2S/c24-20-8-10-21(11-9-20)26-18-16-25(17-19-26)15-5-14-23(12-4-13-23)29(27,28)22-6-2-1-3-7-22/h1-3,6-11H,4-5,12-19H2 |
| InChIKey | JCOVMJAQKRWFIO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |