C24H28N2O2S — CID 21048890
2-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 21048890) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 21048890 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=S(=O)(c1ccccc1)C1(CCCN2CCc3c([nH]c4ccccc34)C2)CCC1 |
| InChI | InChI=1S/C24H28N2O2S/c27-29(28,19-8-2-1-3-9-19)24(13-6-14-24)15-7-16-26-17-12-21-20-10-4-5-11-22(20)25-23(21)18-26/h1-5,8-11,25H,6-7,12-18H2 |
| InChIKey | RURZNIKWHODTNY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|