C21H25N3O — CID 154638273
1-(benzylamino)-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol (PubChem CID 154638273) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(benzylamino)-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol.
| Compound Name | 1-(benzylamino)-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 154638273 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-(benzylamino)-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-ol |
| SMILES | OC(CNCc1ccccc1)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C21H25N3O/c25-17(13-22-12-16-6-2-1-3-7-16)14-24-11-10-19-18-8-4-5-9-20(18)23-21(19)15-24/h1-9,17,22-23,25H,10-15H2 |
| InChIKey | QIJKLWKFFPKVDG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|