C21H21FN2O — CID 18621486
1-(4-fluorophenyl)-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one (PubChem CID 18621486) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 18621486 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
| SMILES | O=C(CCCN1CCc2c([nH]c3ccccc23)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O/c22-16-9-7-15(8-10-16)21(25)6-3-12-24-13-11-18-17-4-1-2-5-19(17)23-20(18)14-24/h1-2,4-5,7-10,23H,3,6,11-14H2 |
| InChIKey | NIZIRIAUHCAHCR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|