C23H29NO2S — CID 21048858
2-[4-[1-(benzenesulfonyl)cyclobutyl]butyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 21048858) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-[4-[1-(benzenesulfonyl)cyclobutyl]butyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[4-[1-(benzenesulfonyl)cyclobutyl]butyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 21048858 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[4-[1-(benzenesulfonyl)cyclobutyl]butyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1ccccc1)C1(CCCCN2CCc3ccccc3C2)CCC1 |
| InChI | InChI=1S/C23H29NO2S/c25-27(26,22-11-2-1-3-12-22)23(15-8-16-23)14-6-7-17-24-18-13-20-9-4-5-10-21(20)19-24/h1-5,9-12H,6-8,13-19H2 |
| InChIKey | YXPZARBZRORYGI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|