C26H33NO3S — CID 21048775
[1-[3-[1-(3-methylphenyl)sulfonylcyclobutyl]propyl]piperidin-4-yl]-phenylmethanone (PubChem CID 21048775) has the molecular formula C26H33NO3S and a molecular weight of 439.62 g/mol. Its IUPAC name is [1-[3-[1-(3-methylphenyl)sulfonylcyclobutyl]propyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[3-[1-(3-methylphenyl)sulfonylcyclobutyl]propyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 21048775 |
| Molecular Formula | C26H33NO3S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | [1-[3-[1-(3-methylphenyl)sulfonylcyclobutyl]propyl]piperidin-4-yl]-phenylmethanone |
| SMILES | Cc1cccc(S(=O)(=O)C2(CCCN3CCC(C(=O)c4ccccc4)CC3)CCC2)c1 |
| InChI | InChI=1S/C26H33NO3S/c1-21-8-5-11-24(20-21)31(29,30)26(14-6-15-26)16-7-17-27-18-12-23(13-19-27)25(28)22-9-3-2-4-10-22/h2-5,8-11,20,23H,6-7,12-19H2,1H3 |
| InChIKey | POMDLJAQGJDUQW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |