C23H27NO4S — CID 57119563
[3-(1-but-2-enylpiperidine-4-carbonyl)phenyl] 3-methylbenzenesulfonate (PubChem CID 57119563) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is [3-(1-but-2-enylpiperidine-4-carbonyl)phenyl] 3-methylbenzenesulfonate.
| Compound Name | [3-(1-but-2-enylpiperidine-4-carbonyl)phenyl] 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57119563 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [3-(1-but-2-enylpiperidine-4-carbonyl)phenyl] 3-methylbenzenesulfonate |
| SMILES | CC=CCN1CCC(C(=O)c2cccc(OS(=O)(=O)c3cccc(C)c3)c2)CC1 |
| InChI | InChI=1S/C23H27NO4S/c1-3-4-13-24-14-11-19(12-15-24)23(25)20-8-6-9-21(17-20)28-29(26,27)22-10-5-7-18(2)16-22/h3-10,16-17,19H,11-15H2,1-2H3 |
| InChIKey | DPCKIKRDFUYDHI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|