C19H19BrF3NO4S — CID 23499453
[3-(1-methylpiperidine-4-carbonyl)phenyl] 2,3,5-trifluorobenzenesulfonate;hydrobromide (PubChem CID 23499453) has the molecular formula C19H19BrF3NO4S and a molecular weight of 494.33 g/mol. Its IUPAC name is [3-(1-methylpiperidine-4-carbonyl)phenyl] 2,3,5-trifluorobenzenesulfonate;hydrobromide.
| Compound Name | [3-(1-methylpiperidine-4-carbonyl)phenyl] 2,3,5-trifluorobenzenesulfonate;hydrobromide |
|---|---|
| PubChem CID | 23499453 |
| Molecular Formula | C19H19BrF3NO4S |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | [3-(1-methylpiperidine-4-carbonyl)phenyl] 2,3,5-trifluorobenzenesulfonate;hydrobromide |
| SMILES | Br.CN1CCC(C(=O)c2cccc(OS(=O)(=O)c3cc(F)cc(F)c3F)c2)CC1 |
| InChI | InChI=1S/C19H18F3NO4S.BrH/c1-23-7-5-12(6-8-23)19(24)13-3-2-4-15(9-13)27-28(25,26)17-11-14(20)10-16(21)18(17)22;/h2-4,9-12H,5-8H2,1H3;1H |
| InChIKey | SLBWAJFNRAGIOK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|