C20H20F3N3OS — CID 87796707
1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-1-(3,4,5-trifluorophenyl)thiourea (PubChem CID 87796707) has the molecular formula C20H20F3N3OS and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-1-(3,4,5-trifluorophenyl)thiourea.
| Compound Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-1-(3,4,5-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 87796707 |
| Molecular Formula | C20H20F3N3OS |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-1-(3,4,5-trifluorophenyl)thiourea |
| SMILES | CN1CCC(C(=O)c2cccc(N(C(N)=S)c3cc(F)c(F)c(F)c3)c2)CC1 |
| InChI | InChI=1S/C20H20F3N3OS/c1-25-7-5-12(6-8-25)19(27)13-3-2-4-14(9-13)26(20(24)28)15-10-16(21)18(23)17(22)11-15/h2-4,9-12H,5-8H2,1H3,(H2,24,28) |
| InChIKey | QLLBIIVOBUVCSH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|