C20H22F3N3O8S3 — CID 87797044
1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,5-trifluorophenyl)thiourea;sulfo hydrogen sulfate (PubChem CID 87797044) has the molecular formula C20H22F3N3O8S3 and a molecular weight of 585.60 g/mol. Its IUPAC name is 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,5-trifluorophenyl)thiourea;sulfo hydrogen sulfate.
| Compound Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,5-trifluorophenyl)thiourea;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 87797044 |
| Molecular Formula | C20H22F3N3O8S3 |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,5-trifluorophenyl)thiourea;sulfo hydrogen sulfate |
| SMILES | CN1CCC(C(=O)c2cccc(NC(=S)Nc3cc(F)cc(F)c3F)c2)CC1.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C20H20F3N3OS.H2O7S2/c1-26-7-5-12(6-8-26)19(27)13-3-2-4-15(9-13)24-20(28)25-17-11-14(21)10-16(22)18(17)23;1-8(2,3)7-9(4,5)6/h2-4,9-12H,5-8H2,1H3,(H2,24,25,28);(H,1,2,3)(H,4,5,6) |
| InChIKey | USQBIWFKMVHHCS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|