C28H35F4N3O4 — CID 87796576
1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,4,5-tetrafluorophenyl)urea;octanoic acid (PubChem CID 87796576) has the molecular formula C28H35F4N3O4 and a molecular weight of 553.60 g/mol. Its IUPAC name is 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,4,5-tetrafluorophenyl)urea;octanoic acid.
| Compound Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,4,5-tetrafluorophenyl)urea;octanoic acid |
|---|---|
| PubChem CID | 87796576 |
| Molecular Formula | C28H35F4N3O4 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 1-[3-(1-methylpiperidine-4-carbonyl)phenyl]-3-(2,3,4,5-tetrafluorophenyl)urea;octanoic acid |
| SMILES | CCCCCCCC(=O)O.CN1CCC(C(=O)c2cccc(NC(=O)Nc3cc(F)c(F)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C20H19F4N3O2.C8H16O2/c1-27-7-5-11(6-8-27)19(28)12-3-2-4-13(9-12)25-20(29)26-15-10-14(21)16(22)18(24)17(15)23;1-2-3-4-5-6-7-8(9)10/h2-4,9-11H,5-8H2,1H3,(H2,25,26,29);2-7H2,1H3,(H,9,10) |
| InChIKey | WTCNSRLLSGIDAL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|