C20H20F2N3O5PS — CID 140504556
1-(3,4-difluorophenyl)-1-[3-(2-hydroxy-9-methyl-2-oxo-1,3-dioxa-9-aza-2λ5-phosphaspiro[3.5]nonane-6-carbonyl)phenyl]thiourea (PubChem CID 140504556) has the molecular formula C20H20F2N3O5PS and a molecular weight of 483.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-[3-(2-hydroxy-9-methyl-2-oxo-1,3-dioxa-9-aza-2λ5-phosphaspiro[3.5]nonane-6-carbonyl)phenyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-1-[3-(2-hydroxy-9-methyl-2-oxo-1,3-dioxa-9-aza-2λ5-phosphaspiro[3.5]nonane-6-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 140504556 |
| Molecular Formula | C20H20F2N3O5PS |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-[3-(2-hydroxy-9-methyl-2-oxo-1,3-dioxa-9-aza-2λ5-phosphaspiro[3.5]nonane-6-carbonyl)phenyl]thiourea |
| SMILES | CN1CCC(C(=O)c2cccc(N(C(N)=S)c3ccc(F)c(F)c3)c2)CC12OP(=O)(O)O2 |
| InChI | InChI=1S/C20H20F2N3O5PS/c1-24-8-7-13(11-20(24)29-31(27,28)30-20)18(26)12-3-2-4-14(9-12)25(19(23)32)15-5-6-16(21)17(22)10-15/h2-6,9-10,13H,7-8,11H2,1H3,(H2,23,32)(H,27,28) |
| InChIKey | QYAQGHYIRNEDFX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|