C21H22N4OS — CID 57019930
1-(4-cyanophenyl)-1-[3-(1-methylpiperidine-4-carbonyl)phenyl]thiourea (PubChem CID 57019930) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-1-[3-(1-methylpiperidine-4-carbonyl)phenyl]thiourea.
| Compound Name | 1-(4-cyanophenyl)-1-[3-(1-methylpiperidine-4-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 57019930 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-(4-cyanophenyl)-1-[3-(1-methylpiperidine-4-carbonyl)phenyl]thiourea |
| SMILES | CN1CCC(C(=O)c2cccc(N(C(N)=S)c3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C21H22N4OS/c1-24-11-9-16(10-12-24)20(26)17-3-2-4-19(13-17)25(21(23)27)18-7-5-15(14-22)6-8-18/h2-8,13,16H,9-12H2,1H3,(H2,23,27) |
| InChIKey | SFKHZXSTWNBCDR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|