C20H20N2O4S — CID 23499279
[3-(1-methylpiperidine-4-carbonyl)phenyl] 4-cyanobenzenesulfonate (PubChem CID 23499279) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is [3-(1-methylpiperidine-4-carbonyl)phenyl] 4-cyanobenzenesulfonate.
| Compound Name | [3-(1-methylpiperidine-4-carbonyl)phenyl] 4-cyanobenzenesulfonate |
|---|---|
| PubChem CID | 23499279 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [3-(1-methylpiperidine-4-carbonyl)phenyl] 4-cyanobenzenesulfonate |
| SMILES | CN1CCC(C(=O)c2cccc(OS(=O)(=O)c3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C20H20N2O4S/c1-22-11-9-16(10-12-22)20(23)17-3-2-4-18(13-17)26-27(24,25)19-7-5-15(14-21)6-8-19/h2-8,13,16H,9-12H2,1H3 |
| InChIKey | JZDRPCNTNVUAOK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|