C22H24N2O4S — CID 7201143
[3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] 4-cyanobenzenesulfonate (PubChem CID 7201143) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] 4-cyanobenzenesulfonate.
| Compound Name | [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] 4-cyanobenzenesulfonate |
|---|---|
| PubChem CID | 7201143 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] 4-cyanobenzenesulfonate |
| SMILES | CC[C@]1(c2cccc(OS(=O)(=O)c3ccc(C#N)cc3)c2)CCCCN(C)C1=O |
| InChI | InChI=1S/C22H24N2O4S/c1-3-22(13-4-5-14-24(2)21(22)25)18-7-6-8-19(15-18)28-29(26,27)20-11-9-17(16-23)10-12-20/h6-12,15H,3-5,13-14H2,1-2H3/t22-/m1/s1 |
| InChIKey | PZBZTBWJXULYBP-JOCHJYFZSA-N |
| XLogP | 3.62 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|